About (E)-4-(2,6,6-trimethyl-3-triethylsilyloxycyclohexen-1-yl)but-3-en-2-one
(E)-4-(2,6,6-trimethyl-3-triethylsilyloxycyclohexen-1-yl)but-3-en-2-one (PubChem CID 11099337) has the molecular formula C19H34O2Si
and a molecular weight of 322.57 g/mol. Its IUPAC name is (E)-4-(2,6,6-trimethyl-3-triethylsilyloxycyclohexen-1-yl)but-3-en-2-one.
Molecular Properties
| Compound Name | (E)-4-(2,6,6-trimethyl-3-triethylsilyloxycyclohexen-1-yl)but-3-en-2-one |
| PubChem CID | 11099337 |
| Molecular Formula | C19H34O2Si |
| Molecular Weight | 322.57 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | (E)-4-(2,6,6-trimethyl-3-triethylsilyloxycyclohexen-1-yl)but-3-en-2-one |
| SMILES | CC[Si](CC)(CC)OC1CCC(C)(C)C(/C=C/C(C)=O)=C1C |
| InChI | InChI=1S/C19H34O2Si/c1-8-22(9-2,10-3)21-18-13-14-19(6,7)17(16(18)5)12-11-15(4)20/h11-12,18H,8-10,13-14H2,1-7H3/b12-11+ |
| InChIKey | ZARJDUDQGMWOHX-VAWYXSNFSA-N |
| XLogP | 5.66 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 322.57 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-4-(2,6,6-trimethyl-3-triethylsilyloxycyclohexen-1-yl)but-3-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-(2,6,6-trimethyl-3-triethylsilyloxycyclohexen-1-yl)but-3-en-2-one?
The IUPAC name of (E)-4-(2,6,6-trimethyl-3-triethylsilyloxycyclohexen-1-yl)but-3-en-2-one (CID 11099337) is (E)-4-(2,6,6-trimethyl-3-triethylsilyloxycyclohexen-1-yl)but-3-en-2-one.
What is the SMILES notation for (E)-4-(2,6,6-trimethyl-3-triethylsilyloxycyclohexen-1-yl)but-3-en-2-one?
The canonical SMILES for (E)-4-(2,6,6-trimethyl-3-triethylsilyloxycyclohexen-1-yl)but-3-en-2-one is CC[Si](CC)(CC)OC1CCC(C)(C)C(/C=C/C(C)=O)=C1C.
What is the InChIKey of (E)-4-(2,6,6-trimethyl-3-triethylsilyloxycyclohexen-1-yl)but-3-en-2-one?
The InChIKey is ZARJDUDQGMWOHX-VAWYXSNFSA-N. The full InChI is InChI=1S/C19H34O2Si/c1-8-22(9-2,10-3)21-18-13-14-19(6,7)17(16(18)5)12-11-15(4)20/h11-12,18H,8-10,13-14H2,1-7H3/b12-11+.
What are the key properties of (E)-4-(2,6,6-trimethyl-3-triethylsilyloxycyclohexen-1-yl)but-3-en-2-one?
(E)-4-(2,6,6-trimethyl-3-triethylsilyloxycyclohexen-1-yl)but-3-en-2-one has a molecular weight of 322.57 g/mol, XLogP of 5.66, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-(2,6,6-trimethyl-3-triethylsilyloxycyclohexen-1-yl)but-3-en-2-one is sourced from PubChem (CID 11099337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).