C17H32F3IN4O2 — CID 110994392
ethyl 1-[N-ethyl-N'-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]carbamimidoyl]piperidine-3-carboxylate;hydroiodide (PubChem CID 110994392) has the molecular formula C17H32F3IN4O2 and a molecular weight of 508.37 g/mol. Its IUPAC name is ethyl 1-[N-ethyl-N'-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]carbamimidoyl]piperidine-3-carboxylate;hydroiodide.
| Compound Name | ethyl 1-[N-ethyl-N'-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]carbamimidoyl]piperidine-3-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 110994392 |
| Molecular Formula | C17H32F3IN4O2 |
| Molecular Weight | 508.37 g/mol |
| Exact Mass | 508.15 |
| IUPAC Name | ethyl 1-[N-ethyl-N'-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]carbamimidoyl]piperidine-3-carboxylate;hydroiodide |
| SMILES | CCN/C(=N\CCCN(C)CC(F)(F)F)N1CCCC(C(=O)OCC)C1.I |
| InChI | InChI=1S/C17H31F3N4O2.HI/c1-4-21-16(22-9-7-10-23(3)13-17(18,19)20)24-11-6-8-14(12-24)15(25)26-5-2;/h14H,4-13H2,1-3H3,(H,21,22);1H |
| InChIKey | NEWQCRNLAHOCGR-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.37 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|