C20H31N3O4 — CID 110994437
ethyl 1-[N-ethyl-N'-[2-hydroxy-2-(4-methoxyphenyl)ethyl]carbamimidoyl]piperidine-3-carboxylate (PubChem CID 110994437) has the molecular formula C20H31N3O4 and a molecular weight of 377.49 g/mol. Its IUPAC name is ethyl 1-[N-ethyl-N'-[2-hydroxy-2-(4-methoxyphenyl)ethyl]carbamimidoyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[N-ethyl-N'-[2-hydroxy-2-(4-methoxyphenyl)ethyl]carbamimidoyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 110994437 |
| Molecular Formula | C20H31N3O4 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.23 |
| IUPAC Name | ethyl 1-[N-ethyl-N'-[2-hydroxy-2-(4-methoxyphenyl)ethyl]carbamimidoyl]piperidine-3-carboxylate |
| SMILES | CCN/C(=N\CC(O)c1ccc(OC)cc1)N1CCCC(C(=O)OCC)C1 |
| InChI | InChI=1S/C20H31N3O4/c1-4-21-20(23-12-6-7-16(14-23)19(25)27-5-2)22-13-18(24)15-8-10-17(26-3)11-9-15/h8-11,16,18,24H,4-7,12-14H2,1-3H3,(H,21,22) |
| InChIKey | GVIKXAIUMGPRGP-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|