C21H34N4O2S — CID 110994641
ethyl 1-[N-ethyl-N'-[3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)propyl]carbamimidoyl]piperidine-3-carboxylate (PubChem CID 110994641) has the molecular formula C21H34N4O2S and a molecular weight of 406.60 g/mol. Its IUPAC name is ethyl 1-[N-ethyl-N'-[3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)propyl]carbamimidoyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[N-ethyl-N'-[3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)propyl]carbamimidoyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 110994641 |
| Molecular Formula | C21H34N4O2S |
| Molecular Weight | 406.60 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | ethyl 1-[N-ethyl-N'-[3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)propyl]carbamimidoyl]piperidine-3-carboxylate |
| SMILES | CCN/C(=N\CCCc1nc2c(s1)CCCC2)N1CCCC(C(=O)OCC)C1 |
| InChI | InChI=1S/C21H34N4O2S/c1-3-22-21(25-14-8-9-16(15-25)20(26)27-4-2)23-13-7-12-19-24-17-10-5-6-11-18(17)28-19/h16H,3-15H2,1-2H3,(H,22,23) |
| InChIKey | BPDQIESEMLXNBV-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 66.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.60 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|