C25H28IN5O — CID 110995286
1-[2-(1H-indol-3-yl)ethyl]-2-methyl-3-[(2-phenylmethoxy-3-pyridinyl)methyl]guanidine;hydroiodide (PubChem CID 110995286) has the molecular formula C25H28IN5O and a molecular weight of 541.44 g/mol. Its IUPAC name is 1-[2-(1H-indol-3-yl)ethyl]-2-methyl-3-[(2-phenylmethoxy-3-pyridinyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(1H-indol-3-yl)ethyl]-2-methyl-3-[(2-phenylmethoxy-3-pyridinyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110995286 |
| Molecular Formula | C25H28IN5O |
| Molecular Weight | 541.44 g/mol |
| Exact Mass | 541.13 |
| IUPAC Name | 1-[2-(1H-indol-3-yl)ethyl]-2-methyl-3-[(2-phenylmethoxy-3-pyridinyl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1c[nH]c2ccccc12)NCc1cccnc1OCc1ccccc1.I |
| InChI | InChI=1S/C25H27N5O.HI/c1-26-25(28-15-13-20-16-29-23-12-6-5-11-22(20)23)30-17-21-10-7-14-27-24(21)31-18-19-8-3-2-4-9-19;/h2-12,14,16,29H,13,15,17-18H2,1H3,(H2,26,28,30);1H |
| InChIKey | PSGJMKOMKIYNFJ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.44 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|