C25H34IN5O — CID 110995538
1-[2-(1H-indol-3-yl)ethyl]-2-methyl-3-[[3-[(2-methylmorpholin-4-yl)methyl]phenyl]methyl]guanidine;hydroiodide (PubChem CID 110995538) has the molecular formula C25H34IN5O and a molecular weight of 547.49 g/mol. Its IUPAC name is 1-[2-(1H-indol-3-yl)ethyl]-2-methyl-3-[[3-[(2-methylmorpholin-4-yl)methyl]phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(1H-indol-3-yl)ethyl]-2-methyl-3-[[3-[(2-methylmorpholin-4-yl)methyl]phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110995538 |
| Molecular Formula | C25H34IN5O |
| Molecular Weight | 547.49 g/mol |
| Exact Mass | 547.18 |
| IUPAC Name | 1-[2-(1H-indol-3-yl)ethyl]-2-methyl-3-[[3-[(2-methylmorpholin-4-yl)methyl]phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1c[nH]c2ccccc12)NCc1cccc(CN2CCOC(C)C2)c1.I |
| InChI | InChI=1S/C25H33N5O.HI/c1-19-17-30(12-13-31-19)18-21-7-5-6-20(14-21)15-29-25(26-2)27-11-10-22-16-28-24-9-4-3-8-23(22)24;/h3-9,14,16,19,28H,10-13,15,17-18H2,1-2H3,(H2,26,27,29);1H |
| InChIKey | BSLUYVABEDFBQV-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.49 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|