C15H28O6Si — CID 11099635
trimethyl-[[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methoxy]silane (PubChem CID 11099635) has the molecular formula C15H28O6Si and a molecular weight of 332.47 g/mol. Its IUPAC name is trimethyl-[[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methoxy]silane.
| Compound Name | trimethyl-[[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methoxy]silane |
|---|---|
| PubChem CID | 11099635 |
| Molecular Formula | C15H28O6Si |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | trimethyl-[[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methoxy]silane |
| SMILES | CC1(C)O[C@H]2[C@@H](O1)[C@@H](CO[Si](C)(C)C)O[C@@H]1OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C15H28O6Si/c1-14(2)18-10-9(8-16-22(5,6)7)17-13-12(11(10)19-14)20-15(3,4)21-13/h9-13H,8H2,1-7H3/t9-,10+,11+,12-,13-/m1/s1 |
| InChIKey | IUGHPMGFBJICPH-KSSYENDESA-N |
| XLogP | 2.23 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|