C24H44IN5O — CID 110999198
1-[5-(diethylamino)pentan-2-yl]-3-[2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-2-methylguanidine;hydroiodide (PubChem CID 110999198) has the molecular formula C24H44IN5O and a molecular weight of 545.55 g/mol. Its IUPAC name is 1-[5-(diethylamino)pentan-2-yl]-3-[2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[5-(diethylamino)pentan-2-yl]-3-[2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110999198 |
| Molecular Formula | C24H44IN5O |
| Molecular Weight | 545.55 g/mol |
| Exact Mass | 545.26 |
| IUPAC Name | 1-[5-(diethylamino)pentan-2-yl]-3-[2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-2-methylguanidine;hydroiodide |
| SMILES | CCN(CC)CCCC(C)N/C(=N\C)NCC(c1ccc(OC)cc1)N1CCCC1.I |
| InChI | InChI=1S/C24H43N5O.HI/c1-6-28(7-2)16-10-11-20(3)27-24(25-4)26-19-23(29-17-8-9-18-29)21-12-14-22(30-5)15-13-21;/h12-15,20,23H,6-11,16-19H2,1-5H3,(H2,25,26,27);1H |
| InChIKey | DNBLIIFAFGWOEU-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 52.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.55 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|