C13H24IN3S — CID 111000522
1-ethyl-3-(3-methylbutan-2-yl)-2-(thiophen-3-ylmethyl)guanidine;hydroiodide (PubChem CID 111000522) has the molecular formula C13H24IN3S and a molecular weight of 381.33 g/mol. Its IUPAC name is 1-ethyl-3-(3-methylbutan-2-yl)-2-(thiophen-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-(3-methylbutan-2-yl)-2-(thiophen-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111000522 |
| Molecular Formula | C13H24IN3S |
| Molecular Weight | 381.33 g/mol |
| Exact Mass | 381.07 |
| IUPAC Name | 1-ethyl-3-(3-methylbutan-2-yl)-2-(thiophen-3-ylmethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccsc1)NC(C)C(C)C.I |
| InChI | InChI=1S/C13H23N3S.HI/c1-5-14-13(16-11(4)10(2)3)15-8-12-6-7-17-9-12;/h6-7,9-11H,5,8H2,1-4H3,(H2,14,15,16);1H |
| InChIKey | VKJSPXILXPNMRJ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.33 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|