C16H31BrOSi — CID 11100103
[(2E,6E)-8-bromo-2,6-dimethylocta-2,6-dienoxy]-tert-butyl-dimethylsilane (PubChem CID 11100103) has the molecular formula C16H31BrOSi and a molecular weight of 347.41 g/mol. Its IUPAC name is [(2E,6E)-8-bromo-2,6-dimethylocta-2,6-dienoxy]-tert-butyl-dimethylsilane.
| Compound Name | [(2E,6E)-8-bromo-2,6-dimethylocta-2,6-dienoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 11100103 |
| Molecular Formula | C16H31BrOSi |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | [(2E,6E)-8-bromo-2,6-dimethylocta-2,6-dienoxy]-tert-butyl-dimethylsilane |
| SMILES | C/C(=C\CBr)CC/C=C(\C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H31BrOSi/c1-14(11-12-17)9-8-10-15(2)13-18-19(6,7)16(3,4)5/h10-11H,8-9,12-13H2,1-7H3/b14-11+,15-10+ |
| InChIKey | MGBWAWUVKUZMJT-QYFSLLALSA-N |
| XLogP | 6.08 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|