C17H22N2O4S — CID 11100208
1-[(3aS,6aS,11bR)-2-hydroxy-7-methylsulfonyl-2,3a,4,5,6,6a-hexahydro-1H-pyrrolo[2,3-d]carbazol-3-yl]ethanone (PubChem CID 11100208) has the molecular formula C17H22N2O4S and a molecular weight of 350.44 g/mol. Its IUPAC name is 1-[(3aS,6aS,11bR)-2-hydroxy-7-methylsulfonyl-2,3a,4,5,6,6a-hexahydro-1H-pyrrolo[2,3-d]carbazol-3-yl]ethanone.
| Compound Name | 1-[(3aS,6aS,11bR)-2-hydroxy-7-methylsulfonyl-2,3a,4,5,6,6a-hexahydro-1H-pyrrolo[2,3-d]carbazol-3-yl]ethanone |
|---|---|
| PubChem CID | 11100208 |
| Molecular Formula | C17H22N2O4S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | 1-[(3aS,6aS,11bR)-2-hydroxy-7-methylsulfonyl-2,3a,4,5,6,6a-hexahydro-1H-pyrrolo[2,3-d]carbazol-3-yl]ethanone |
| SMILES | CC(=O)N1C(O)C[C@]23c4ccccc4N(S(C)(=O)=O)[C@H]2CCC[C@H]13 |
| InChI | InChI=1S/C17H22N2O4S/c1-11(20)18-14-8-5-9-15-17(14,10-16(18)21)12-6-3-4-7-13(12)19(15)24(2,22)23/h3-4,6-7,14-16,21H,5,8-10H2,1-2H3/t14-,15-,16?,17+/m0/s1 |
| InChIKey | CBSVAEDFNRTJGA-KXXMQDLISA-N |
| XLogP | 1.20 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |