C22H35FO2 — CID 11100217
ethyl (4E,8Z,12E)-8-fluoro-4,12,16-trimethylheptadeca-4,8,12,16-tetraenoate (PubChem CID 11100217) has the molecular formula C22H35FO2 and a molecular weight of 350.52 g/mol. Its IUPAC name is ethyl (4E,8Z,12E)-8-fluoro-4,12,16-trimethylheptadeca-4,8,12,16-tetraenoate.
| Compound Name | ethyl (4E,8Z,12E)-8-fluoro-4,12,16-trimethylheptadeca-4,8,12,16-tetraenoate |
|---|---|
| PubChem CID | 11100217 |
| Molecular Formula | C22H35FO2 |
| Molecular Weight | 350.52 g/mol |
| Exact Mass | 350.26 |
| IUPAC Name | ethyl (4E,8Z,12E)-8-fluoro-4,12,16-trimethylheptadeca-4,8,12,16-tetraenoate |
| SMILES | C=C(C)CC/C=C(\C)CC/C=C(\F)CC/C=C(\C)CCC(=O)OCC |
| InChI | InChI=1S/C22H35FO2/c1-6-25-22(24)17-16-20(5)13-9-15-21(23)14-8-12-19(4)11-7-10-18(2)3/h11,13-14H,2,6-10,12,15-17H2,1,3-5H3/b19-11+,20-13+,21-14- |
| InChIKey | YODOLLDQODOQBA-GIZONNAJSA-N |
| XLogP | 6.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.52 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|