C22H38O3 — CID 11100220
(2E,6E,10E)-3,7,11-trimethyl-13-(2-propan-2-yl-1,3-dioxolan-2-yl)trideca-2,6,10-trien-1-ol (PubChem CID 11100220) has the molecular formula C22H38O3 and a molecular weight of 350.54 g/mol. Its IUPAC name is (2E,6E,10E)-3,7,11-trimethyl-13-(2-propan-2-yl-1,3-dioxolan-2-yl)trideca-2,6,10-trien-1-ol.
| Compound Name | (2E,6E,10E)-3,7,11-trimethyl-13-(2-propan-2-yl-1,3-dioxolan-2-yl)trideca-2,6,10-trien-1-ol |
|---|---|
| PubChem CID | 11100220 |
| Molecular Formula | C22H38O3 |
| Molecular Weight | 350.54 g/mol |
| Exact Mass | 350.28 |
| IUPAC Name | (2E,6E,10E)-3,7,11-trimethyl-13-(2-propan-2-yl-1,3-dioxolan-2-yl)trideca-2,6,10-trien-1-ol |
| SMILES | C/C(=C\CO)CC/C=C(\C)CC/C=C(\C)CCC1(C(C)C)OCCO1 |
| InChI | InChI=1S/C22H38O3/c1-18(2)22(24-16-17-25-22)14-12-20(4)10-6-8-19(3)9-7-11-21(5)13-15-23/h9-10,13,18,23H,6-8,11-12,14-17H2,1-5H3/b19-9+,20-10+,21-13+ |
| InChIKey | XOEARHCIMASUKD-IUNOABEHSA-N |
| XLogP | 5.56 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.54 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|