C20H21NO3S — CID 11100346
(2S,3S)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-oxazolidin-3-yl]-3-hydroxy-2-methyl-3-phenylpropan-1-one (PubChem CID 11100346) has the molecular formula C20H21NO3S and a molecular weight of 355.46 g/mol. Its IUPAC name is (2S,3S)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-oxazolidin-3-yl]-3-hydroxy-2-methyl-3-phenylpropan-1-one.
| Compound Name | (2S,3S)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-oxazolidin-3-yl]-3-hydroxy-2-methyl-3-phenylpropan-1-one |
|---|---|
| PubChem CID | 11100346 |
| Molecular Formula | C20H21NO3S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | (2S,3S)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-oxazolidin-3-yl]-3-hydroxy-2-methyl-3-phenylpropan-1-one |
| SMILES | C[C@H](C(=O)N1C(=S)OC[C@@H]1Cc1ccccc1)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C20H21NO3S/c1-14(18(22)16-10-6-3-7-11-16)19(23)21-17(13-24-20(21)25)12-15-8-4-2-5-9-15/h2-11,14,17-18,22H,12-13H2,1H3/t14-,17-,18-/m0/s1 |
| InChIKey | JAUCBPJIASDPSK-WBAXXEDZSA-N |
| XLogP | 3.11 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|