C19H16O7 — CID 11100364
5-(3,4,5-trimethoxyphenyl)-[1,3]dioxolo[4,5-g]isochromen-7-one (PubChem CID 11100364) has the molecular formula C19H16O7 and a molecular weight of 356.33 g/mol. Its IUPAC name is 5-(3,4,5-trimethoxyphenyl)-[1,3]dioxolo[4,5-g]isochromen-7-one.
| Compound Name | 5-(3,4,5-trimethoxyphenyl)-[1,3]dioxolo[4,5-g]isochromen-7-one |
|---|---|
| PubChem CID | 11100364 |
| Molecular Formula | C19H16O7 |
| Molecular Weight | 356.33 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | 5-(3,4,5-trimethoxyphenyl)-[1,3]dioxolo[4,5-g]isochromen-7-one |
| SMILES | COc1cc(-c2oc(=O)cc3cc4c(cc23)OCO4)cc(OC)c1OC |
| InChI | InChI=1S/C19H16O7/c1-21-15-5-11(6-16(22-2)19(15)23-3)18-12-8-14-13(24-9-25-14)4-10(12)7-17(20)26-18/h4-8H,9H2,1-3H3 |
| InChIKey | AFNMVBGXQXTTGR-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 76.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.33 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |