C19H37F3IN5O — CID 111003970
2-methyl-1-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-3-[(1-morpholin-4-ylcyclohexyl)methyl]guanidine;hydroiodide (PubChem CID 111003970) has the molecular formula C19H37F3IN5O and a molecular weight of 535.44 g/mol. Its IUPAC name is 2-methyl-1-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-3-[(1-morpholin-4-ylcyclohexyl)methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-3-[(1-morpholin-4-ylcyclohexyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111003970 |
| Molecular Formula | C19H37F3IN5O |
| Molecular Weight | 535.44 g/mol |
| Exact Mass | 535.20 |
| IUPAC Name | 2-methyl-1-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-3-[(1-morpholin-4-ylcyclohexyl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCN(C)CC(F)(F)F)NCC1(N2CCOCC2)CCCCC1.I |
| InChI | InChI=1S/C19H36F3N5O.HI/c1-23-17(24-9-6-10-26(2)16-19(20,21)22)25-15-18(7-4-3-5-8-18)27-11-13-28-14-12-27;/h3-16H2,1-2H3,(H2,23,24,25);1H |
| InChIKey | ALGXWALGHOAYNH-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 52.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.44 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|