C19H36F3N5O — CID 111003971
2-methyl-1-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-3-[(1-morpholin-4-ylcyclohexyl)methyl]guanidine (PubChem CID 111003971) has the molecular formula C19H36F3N5O and a molecular weight of 407.53 g/mol. Its IUPAC name is 2-methyl-1-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-3-[(1-morpholin-4-ylcyclohexyl)methyl]guanidine.
| Compound Name | 2-methyl-1-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-3-[(1-morpholin-4-ylcyclohexyl)methyl]guanidine |
|---|---|
| PubChem CID | 111003971 |
| Molecular Formula | C19H36F3N5O |
| Molecular Weight | 407.53 g/mol |
| Exact Mass | 407.29 |
| IUPAC Name | 2-methyl-1-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-3-[(1-morpholin-4-ylcyclohexyl)methyl]guanidine |
| SMILES | C/N=C(\NCCCN(C)CC(F)(F)F)NCC1(N2CCOCC2)CCCCC1 |
| InChI | InChI=1S/C19H36F3N5O/c1-23-17(24-9-6-10-26(2)16-19(20,21)22)25-15-18(7-4-3-5-8-18)27-11-13-28-14-12-27/h3-16H2,1-2H3,(H2,23,24,25) |
| InChIKey | ORSPNIADLVQKIF-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 52.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.53 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|