C20H39F3IN5O — CID 111003972
1-ethyl-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-2-[(1-morpholin-4-ylcyclohexyl)methyl]guanidine;hydroiodide (PubChem CID 111003972) has the molecular formula C20H39F3IN5O and a molecular weight of 549.46 g/mol. Its IUPAC name is 1-ethyl-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-2-[(1-morpholin-4-ylcyclohexyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-2-[(1-morpholin-4-ylcyclohexyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111003972 |
| Molecular Formula | C20H39F3IN5O |
| Molecular Weight | 549.46 g/mol |
| Exact Mass | 549.22 |
| IUPAC Name | 1-ethyl-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-2-[(1-morpholin-4-ylcyclohexyl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC1(N2CCOCC2)CCCCC1)NCCCN(C)CC(F)(F)F.I |
| InChI | InChI=1S/C20H38F3N5O.HI/c1-3-24-18(25-10-7-11-27(2)17-20(21,22)23)26-16-19(8-5-4-6-9-19)28-12-14-29-15-13-28;/h3-17H2,1-2H3,(H2,24,25,26);1H |
| InChIKey | RHLMWKFAFWQAIX-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 52.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.46 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|