About 4-[4-(4-methylpiperazin-1-yl)phenyl]-10H-imidazo[2,1-c][1,4]benzodiazepine
4-[4-(4-methylpiperazin-1-yl)phenyl]-10H-imidazo[2,1-c][1,4]benzodiazepine (PubChem CID 11100413) has the molecular formula C22H23N5
and a molecular weight of 357.46 g/mol. Its IUPAC name is 4-[4-(4-methylpiperazin-1-yl)phenyl]-10H-imidazo[2,1-c][1,4]benzodiazepine.
Molecular Properties
| Compound Name | 4-[4-(4-methylpiperazin-1-yl)phenyl]-10H-imidazo[2,1-c][1,4]benzodiazepine |
| PubChem CID | 11100413 |
| Molecular Formula | C22H23N5 |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.20 |
| IUPAC Name | 4-[4-(4-methylpiperazin-1-yl)phenyl]-10H-imidazo[2,1-c][1,4]benzodiazepine |
| SMILES | CN1CCN(c2ccc(C3=Nc4ccccc4Cn4ccnc43)cc2)CC1 |
| InChI | InChI=1S/C22H23N5/c1-25-12-14-26(15-13-25)19-8-6-17(7-9-19)21-22-23-10-11-27(22)16-18-4-2-3-5-20(18)24-21/h2-11H,12-16H2,1H3 |
| InChIKey | RYCWUNZYQSLZJV-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 36.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[4-(4-methylpiperazin-1-yl)phenyl]-10H-imidazo[2,1-c][1,4]benzodiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(4-methylpiperazin-1-yl)phenyl]-10H-imidazo[2,1-c][1,4]benzodiazepine?
The IUPAC name of 4-[4-(4-methylpiperazin-1-yl)phenyl]-10H-imidazo[2,1-c][1,4]benzodiazepine (CID 11100413) is 4-[4-(4-methylpiperazin-1-yl)phenyl]-10H-imidazo[2,1-c][1,4]benzodiazepine.
What is the SMILES notation for 4-[4-(4-methylpiperazin-1-yl)phenyl]-10H-imidazo[2,1-c][1,4]benzodiazepine?
The canonical SMILES for 4-[4-(4-methylpiperazin-1-yl)phenyl]-10H-imidazo[2,1-c][1,4]benzodiazepine is CN1CCN(c2ccc(C3=Nc4ccccc4Cn4ccnc43)cc2)CC1.
What is the InChIKey of 4-[4-(4-methylpiperazin-1-yl)phenyl]-10H-imidazo[2,1-c][1,4]benzodiazepine?
The InChIKey is RYCWUNZYQSLZJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23N5/c1-25-12-14-26(15-13-25)19-8-6-17(7-9-19)21-22-23-10-11-27(22)16-18-4-2-3-5-20(18)24-21/h2-11H,12-16H2,1H3.
What are the key properties of 4-[4-(4-methylpiperazin-1-yl)phenyl]-10H-imidazo[2,1-c][1,4]benzodiazepine?
4-[4-(4-methylpiperazin-1-yl)phenyl]-10H-imidazo[2,1-c][1,4]benzodiazepine has a molecular weight of 357.46 g/mol, XLogP of 3.17, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(4-methylpiperazin-1-yl)phenyl]-10H-imidazo[2,1-c][1,4]benzodiazepine is sourced from PubChem (CID 11100413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).