C19H26IN5O2 — CID 111004866
N-[2-[[ethylamino-(2-phenoxyethylamino)methylidene]amino]ethyl]pyridine-3-carboxamide;hydroiodide (PubChem CID 111004866) has the molecular formula C19H26IN5O2 and a molecular weight of 483.35 g/mol. Its IUPAC name is N-[2-[[ethylamino-(2-phenoxyethylamino)methylidene]amino]ethyl]pyridine-3-carboxamide;hydroiodide.
| Compound Name | N-[2-[[ethylamino-(2-phenoxyethylamino)methylidene]amino]ethyl]pyridine-3-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111004866 |
| Molecular Formula | C19H26IN5O2 |
| Molecular Weight | 483.35 g/mol |
| Exact Mass | 483.11 |
| IUPAC Name | N-[2-[[ethylamino-(2-phenoxyethylamino)methylidene]amino]ethyl]pyridine-3-carboxamide;hydroiodide |
| SMILES | CCN/C(=N\CCNC(=O)c1cccnc1)NCCOc1ccccc1.I |
| InChI | InChI=1S/C19H25N5O2.HI/c1-2-21-19(24-13-14-26-17-8-4-3-5-9-17)23-12-11-22-18(25)16-7-6-10-20-15-16;/h3-10,15H,2,11-14H2,1H3,(H,22,25)(H2,21,23,24);1H |
| InChIKey | WEVBAIPXLNFRPO-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 87.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.35 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|