About 4-(2,3,5,6-tetrafluoro-4-iodophenyl)morpholine
4-(2,3,5,6-tetrafluoro-4-iodophenyl)morpholine (PubChem CID 11100499) has the molecular formula C10H8F4INO
and a molecular weight of 361.08 g/mol. Its IUPAC name is 4-(2,3,5,6-tetrafluoro-4-iodophenyl)morpholine.
Molecular Properties
| Compound Name | 4-(2,3,5,6-tetrafluoro-4-iodophenyl)morpholine |
| PubChem CID | 11100499 |
| Molecular Formula | C10H8F4INO |
| Molecular Weight | 361.08 g/mol |
| Exact Mass | 360.96 |
| IUPAC Name | 4-(2,3,5,6-tetrafluoro-4-iodophenyl)morpholine |
| SMILES | Fc1c(F)c(N2CCOCC2)c(F)c(F)c1I |
| InChI | InChI=1S/C10H8F4INO/c11-5-7(13)10(8(14)6(12)9(5)15)16-1-3-17-4-2-16/h1-4H2 |
| InChIKey | QJXWJTKODIFTFV-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.08 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,3,5,6-tetrafluoro-4-iodophenyl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,3,5,6-tetrafluoro-4-iodophenyl)morpholine?
The IUPAC name of 4-(2,3,5,6-tetrafluoro-4-iodophenyl)morpholine (CID 11100499) is 4-(2,3,5,6-tetrafluoro-4-iodophenyl)morpholine.
What is the SMILES notation for 4-(2,3,5,6-tetrafluoro-4-iodophenyl)morpholine?
The canonical SMILES for 4-(2,3,5,6-tetrafluoro-4-iodophenyl)morpholine is Fc1c(F)c(N2CCOCC2)c(F)c(F)c1I.
What is the InChIKey of 4-(2,3,5,6-tetrafluoro-4-iodophenyl)morpholine?
The InChIKey is QJXWJTKODIFTFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8F4INO/c11-5-7(13)10(8(14)6(12)9(5)15)16-1-3-17-4-2-16/h1-4H2.
What are the key properties of 4-(2,3,5,6-tetrafluoro-4-iodophenyl)morpholine?
4-(2,3,5,6-tetrafluoro-4-iodophenyl)morpholine has a molecular weight of 361.08 g/mol, XLogP of 2.68, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,3,5,6-tetrafluoro-4-iodophenyl)morpholine is sourced from PubChem (CID 11100499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).