C20H34IN5O2 — CID 111005066
1-[4-[[N'-methyl-N-(2-phenoxyethyl)carbamimidoyl]amino]butyl]piperidine-4-carboxamide;hydroiodide (PubChem CID 111005066) has the molecular formula C20H34IN5O2 and a molecular weight of 503.43 g/mol. Its IUPAC name is 1-[4-[[N'-methyl-N-(2-phenoxyethyl)carbamimidoyl]amino]butyl]piperidine-4-carboxamide;hydroiodide.
| Compound Name | 1-[4-[[N'-methyl-N-(2-phenoxyethyl)carbamimidoyl]amino]butyl]piperidine-4-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111005066 |
| Molecular Formula | C20H34IN5O2 |
| Molecular Weight | 503.43 g/mol |
| Exact Mass | 503.18 |
| IUPAC Name | 1-[4-[[N'-methyl-N-(2-phenoxyethyl)carbamimidoyl]amino]butyl]piperidine-4-carboxamide;hydroiodide |
| SMILES | C/N=C(/NCCCCN1CCC(C(N)=O)CC1)NCCOc1ccccc1.I |
| InChI | InChI=1S/C20H33N5O2.HI/c1-22-20(24-12-16-27-18-7-3-2-4-8-18)23-11-5-6-13-25-14-9-17(10-15-25)19(21)26;/h2-4,7-8,17H,5-6,9-16H2,1H3,(H2,21,26)(H2,22,23,24);1H |
| InChIKey | DNLUPRVVXLOQLU-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 91.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.43 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|