C16F6N4 — CID 11100524
4-(3,4-dicyano-2,5,6-trifluorophenyl)-3,5,6-trifluorobenzene-1,2-dicarbonitrile (PubChem CID 11100524) has the molecular formula C16F6N4 and a molecular weight of 362.19 g/mol. Its IUPAC name is 4-(3,4-dicyano-2,5,6-trifluorophenyl)-3,5,6-trifluorobenzene-1,2-dicarbonitrile.
| Compound Name | 4-(3,4-dicyano-2,5,6-trifluorophenyl)-3,5,6-trifluorobenzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 11100524 |
| Molecular Formula | C16F6N4 |
| Molecular Weight | 362.19 g/mol |
| Exact Mass | 362.00 |
| IUPAC Name | 4-(3,4-dicyano-2,5,6-trifluorophenyl)-3,5,6-trifluorobenzene-1,2-dicarbonitrile |
| SMILES | N#Cc1c(F)c(F)c(-c2c(F)c(F)c(C#N)c(C#N)c2F)c(F)c1C#N |
| InChI | InChI=1S/C16F6N4/c17-11-5(1-23)7(3-25)13(19)15(21)9(11)10-12(18)6(2-24)8(4-26)14(20)16(10)22 |
| InChIKey | BQZYVANYOPKGNF-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.19 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|