C19H23N3O3 — CID 111005357
methyl 4-[[[N'-methyl-N-(2-phenoxyethyl)carbamimidoyl]amino]methyl]benzoate (PubChem CID 111005357) has the molecular formula C19H23N3O3 and a molecular weight of 341.41 g/mol. Its IUPAC name is methyl 4-[[[N'-methyl-N-(2-phenoxyethyl)carbamimidoyl]amino]methyl]benzoate.
| Compound Name | methyl 4-[[[N'-methyl-N-(2-phenoxyethyl)carbamimidoyl]amino]methyl]benzoate |
|---|---|
| PubChem CID | 111005357 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | methyl 4-[[[N'-methyl-N-(2-phenoxyethyl)carbamimidoyl]amino]methyl]benzoate |
| SMILES | C/N=C(\NCCOc1ccccc1)NCc1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C19H23N3O3/c1-20-19(21-12-13-25-17-6-4-3-5-7-17)22-14-15-8-10-16(11-9-15)18(23)24-2/h3-11H,12-14H2,1-2H3,(H2,20,21,22) |
| InChIKey | QKESBNNWZLSRMI-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|