About N-(3-methyl-1,2-thiazol-5-yl)-2-[1-(1,2-oxazol-5-ylmethyl)indol-3-yl]-2-oxoacetamide
N-(3-methyl-1,2-thiazol-5-yl)-2-[1-(1,2-oxazol-5-ylmethyl)indol-3-yl]-2-oxoacetamide (PubChem CID 11100631) has the molecular formula C18H14N4O3S
and a molecular weight of 366.40 g/mol. Its IUPAC name is N-(3-methyl-1,2-thiazol-5-yl)-2-[1-(1,2-oxazol-5-ylmethyl)indol-3-yl]-2-oxoacetamide.
Molecular Properties
| Compound Name | N-(3-methyl-1,2-thiazol-5-yl)-2-[1-(1,2-oxazol-5-ylmethyl)indol-3-yl]-2-oxoacetamide |
| PubChem CID | 11100631 |
| Molecular Formula | C18H14N4O3S |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | N-(3-methyl-1,2-thiazol-5-yl)-2-[1-(1,2-oxazol-5-ylmethyl)indol-3-yl]-2-oxoacetamide |
| SMILES | Cc1cc(NC(=O)C(=O)c2cn(Cc3ccno3)c3ccccc23)sn1 |
| InChI | InChI=1S/C18H14N4O3S/c1-11-8-16(26-21-11)20-18(24)17(23)14-10-22(9-12-6-7-19-25-12)15-5-3-2-4-13(14)15/h2-8,10H,9H2,1H3,(H,20,24) |
| InChIKey | ROLCNFHVHZJEKX-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 90.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.40 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-(3-methyl-1,2-thiazol-5-yl)-2-[1-(1,2-oxazol-5-ylmethyl)indol-3-yl]-2-oxoacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-methyl-1,2-thiazol-5-yl)-2-[1-(1,2-oxazol-5-ylmethyl)indol-3-yl]-2-oxoacetamide?
The IUPAC name of N-(3-methyl-1,2-thiazol-5-yl)-2-[1-(1,2-oxazol-5-ylmethyl)indol-3-yl]-2-oxoacetamide (CID 11100631) is N-(3-methyl-1,2-thiazol-5-yl)-2-[1-(1,2-oxazol-5-ylmethyl)indol-3-yl]-2-oxoacetamide.
What is the SMILES notation for N-(3-methyl-1,2-thiazol-5-yl)-2-[1-(1,2-oxazol-5-ylmethyl)indol-3-yl]-2-oxoacetamide?
The canonical SMILES for N-(3-methyl-1,2-thiazol-5-yl)-2-[1-(1,2-oxazol-5-ylmethyl)indol-3-yl]-2-oxoacetamide is Cc1cc(NC(=O)C(=O)c2cn(Cc3ccno3)c3ccccc23)sn1.
What is the InChIKey of N-(3-methyl-1,2-thiazol-5-yl)-2-[1-(1,2-oxazol-5-ylmethyl)indol-3-yl]-2-oxoacetamide?
The InChIKey is ROLCNFHVHZJEKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14N4O3S/c1-11-8-16(26-21-11)20-18(24)17(23)14-10-22(9-12-6-7-19-25-12)15-5-3-2-4-13(14)15/h2-8,10H,9H2,1H3,(H,20,24).
What are the key properties of N-(3-methyl-1,2-thiazol-5-yl)-2-[1-(1,2-oxazol-5-ylmethyl)indol-3-yl]-2-oxoacetamide?
N-(3-methyl-1,2-thiazol-5-yl)-2-[1-(1,2-oxazol-5-ylmethyl)indol-3-yl]-2-oxoacetamide has a molecular weight of 366.40 g/mol, XLogP of 3.26, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-methyl-1,2-thiazol-5-yl)-2-[1-(1,2-oxazol-5-ylmethyl)indol-3-yl]-2-oxoacetamide is sourced from PubChem (CID 11100631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).