C20H34O4Si — CID 11100655
(3R,4S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-3-methyl-4-phenylmethoxyhexanal (PubChem CID 11100655) has the molecular formula C20H34O4Si and a molecular weight of 366.57 g/mol. Its IUPAC name is (3R,4S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-3-methyl-4-phenylmethoxyhexanal.
| Compound Name | (3R,4S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-3-methyl-4-phenylmethoxyhexanal |
|---|---|
| PubChem CID | 11100655 |
| Molecular Formula | C20H34O4Si |
| Molecular Weight | 366.57 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | (3R,4S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-3-methyl-4-phenylmethoxyhexanal |
| SMILES | C[C@H](O[Si](C)(C)C(C)(C)C)[C@H](OCc1ccccc1)[C@](C)(O)CC=O |
| InChI | InChI=1S/C20H34O4Si/c1-16(24-25(6,7)19(2,3)4)18(20(5,22)13-14-21)23-15-17-11-9-8-10-12-17/h8-12,14,16,18,22H,13,15H2,1-7H3/t16-,18-,20+/m0/s1 |
| InChIKey | AFHCPDSRKBITGZ-XKGZKEIXSA-N |
| XLogP | 4.32 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.57 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|