C26H38N4O2 — CID 111007097
1-ethyl-3-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-2-[[4-(2-methylphenyl)oxan-4-yl]methyl]guanidine (PubChem CID 111007097) has the molecular formula C26H38N4O2 and a molecular weight of 438.62 g/mol. Its IUPAC name is 1-ethyl-3-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-2-[[4-(2-methylphenyl)oxan-4-yl]methyl]guanidine.
| Compound Name | 1-ethyl-3-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-2-[[4-(2-methylphenyl)oxan-4-yl]methyl]guanidine |
|---|---|
| PubChem CID | 111007097 |
| Molecular Formula | C26H38N4O2 |
| Molecular Weight | 438.62 g/mol |
| Exact Mass | 438.30 |
| IUPAC Name | 1-ethyl-3-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-2-[[4-(2-methylphenyl)oxan-4-yl]methyl]guanidine |
| SMILES | CCN/C(=N\CC1(c2ccccc2C)CCOCC1)NCC(c1ccco1)N1CCCC1 |
| InChI | InChI=1S/C26H38N4O2/c1-3-27-25(28-19-23(24-11-8-16-32-24)30-14-6-7-15-30)29-20-26(12-17-31-18-13-26)22-10-5-4-9-21(22)2/h4-5,8-11,16,23H,3,6-7,12-15,17-20H2,1-2H3,(H2,27,28,29) |
| InChIKey | DHWOMAMJJVRFKV-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 62.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.62 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|