C21H26S2Si — CID 11100738
[(1Z)-1,3-bis(phenylsulfanyl)hexa-1,5-dienyl]-trimethylsilane (PubChem CID 11100738) has the molecular formula C21H26S2Si and a molecular weight of 370.66 g/mol. Its IUPAC name is [(1Z)-1,3-bis(phenylsulfanyl)hexa-1,5-dienyl]-trimethylsilane.
| Compound Name | [(1Z)-1,3-bis(phenylsulfanyl)hexa-1,5-dienyl]-trimethylsilane |
|---|---|
| PubChem CID | 11100738 |
| Molecular Formula | C21H26S2Si |
| Molecular Weight | 370.66 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | [(1Z)-1,3-bis(phenylsulfanyl)hexa-1,5-dienyl]-trimethylsilane |
| SMILES | C=CCC(/C=C(\Sc1ccccc1)[Si](C)(C)C)Sc1ccccc1 |
| InChI | InChI=1S/C21H26S2Si/c1-5-12-20(22-18-13-8-6-9-14-18)17-21(24(2,3)4)23-19-15-10-7-11-16-19/h5-11,13-17,20H,1,12H2,2-4H3/b21-17+ |
| InChIKey | CSVNSSSZYOURIJ-HEHNFIMWSA-N |
| XLogP | 7.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.66 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|