C15H21N3O6S — CID 11100746
4-[[[(2S)-2-amino-3-phenylpropanoyl]amino]methylamino]-2-methylsulfonyl-4-oxobutanoic acid (PubChem CID 11100746) has the molecular formula C15H21N3O6S and a molecular weight of 371.42 g/mol. Its IUPAC name is 4-[[[(2S)-2-amino-3-phenylpropanoyl]amino]methylamino]-2-methylsulfonyl-4-oxobutanoic acid.
| Compound Name | 4-[[[(2S)-2-amino-3-phenylpropanoyl]amino]methylamino]-2-methylsulfonyl-4-oxobutanoic acid |
|---|---|
| PubChem CID | 11100746 |
| Molecular Formula | C15H21N3O6S |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | 4-[[[(2S)-2-amino-3-phenylpropanoyl]amino]methylamino]-2-methylsulfonyl-4-oxobutanoic acid |
| SMILES | CS(=O)(=O)C(CC(=O)NCNC(=O)[C@@H](N)Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C15H21N3O6S/c1-25(23,24)12(15(21)22)8-13(19)17-9-18-14(20)11(16)7-10-5-3-2-4-6-10/h2-6,11-12H,7-9,16H2,1H3,(H,17,19)(H,18,20)(H,21,22)/t11-,12?/m0/s1 |
| InChIKey | XQCCNYBROPHYCM-PXYINDEMSA-N |
| XLogP | -1.37 |
| TPSA | 155.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|