C20H42O4Si — CID 11100826
[(6S,7S)-6-[tert-butyl(dimethyl)silyl]oxy-7-hydroxynonan-2-yl] 2,2-dimethylpropanoate (PubChem CID 11100826) has the molecular formula C20H42O4Si and a molecular weight of 374.64 g/mol. Its IUPAC name is [(6S,7S)-6-[tert-butyl(dimethyl)silyl]oxy-7-hydroxynonan-2-yl] 2,2-dimethylpropanoate.
| Compound Name | [(6S,7S)-6-[tert-butyl(dimethyl)silyl]oxy-7-hydroxynonan-2-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 11100826 |
| Molecular Formula | C20H42O4Si |
| Molecular Weight | 374.64 g/mol |
| Exact Mass | 374.29 |
| IUPAC Name | [(6S,7S)-6-[tert-butyl(dimethyl)silyl]oxy-7-hydroxynonan-2-yl] 2,2-dimethylpropanoate |
| SMILES | CC[C@H](O)[C@H](CCCC(C)OC(=O)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H42O4Si/c1-11-16(21)17(24-25(9,10)20(6,7)8)14-12-13-15(2)23-18(22)19(3,4)5/h15-17,21H,11-14H2,1-10H3/t15?,16-,17-/m0/s1 |
| InChIKey | KWAUMHCZGJZZFF-BSOSBYQFSA-N |
| XLogP | 5.30 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.64 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|