About N-[2-(2-benzyl-6-methoxy-3H-inden-1-yl)ethyl]-2,2,2-trifluoroacetamide
N-[2-(2-benzyl-6-methoxy-3H-inden-1-yl)ethyl]-2,2,2-trifluoroacetamide (PubChem CID 11100842) has the molecular formula C21H20F3NO2
and a molecular weight of 375.39 g/mol. Its IUPAC name is N-[2-(2-benzyl-6-methoxy-3H-inden-1-yl)ethyl]-2,2,2-trifluoroacetamide.
Molecular Properties
| Compound Name | N-[2-(2-benzyl-6-methoxy-3H-inden-1-yl)ethyl]-2,2,2-trifluoroacetamide |
| PubChem CID | 11100842 |
| Molecular Formula | C21H20F3NO2 |
| Molecular Weight | 375.39 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | N-[2-(2-benzyl-6-methoxy-3H-inden-1-yl)ethyl]-2,2,2-trifluoroacetamide |
| SMILES | COc1ccc2c(c1)C(CCNC(=O)C(F)(F)F)=C(Cc1ccccc1)C2 |
| InChI | InChI=1S/C21H20F3NO2/c1-27-17-8-7-15-12-16(11-14-5-3-2-4-6-14)18(19(15)13-17)9-10-25-20(26)21(22,23)24/h2-8,13H,9-12H2,1H3,(H,25,26) |
| InChIKey | JDDDHXPCWLVPQC-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.39 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[2-(2-benzyl-6-methoxy-3H-inden-1-yl)ethyl]-2,2,2-trifluoroacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(2-benzyl-6-methoxy-3H-inden-1-yl)ethyl]-2,2,2-trifluoroacetamide?
The IUPAC name of N-[2-(2-benzyl-6-methoxy-3H-inden-1-yl)ethyl]-2,2,2-trifluoroacetamide (CID 11100842) is N-[2-(2-benzyl-6-methoxy-3H-inden-1-yl)ethyl]-2,2,2-trifluoroacetamide.
What is the SMILES notation for N-[2-(2-benzyl-6-methoxy-3H-inden-1-yl)ethyl]-2,2,2-trifluoroacetamide?
The canonical SMILES for N-[2-(2-benzyl-6-methoxy-3H-inden-1-yl)ethyl]-2,2,2-trifluoroacetamide is COc1ccc2c(c1)C(CCNC(=O)C(F)(F)F)=C(Cc1ccccc1)C2.
What is the InChIKey of N-[2-(2-benzyl-6-methoxy-3H-inden-1-yl)ethyl]-2,2,2-trifluoroacetamide?
The InChIKey is JDDDHXPCWLVPQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20F3NO2/c1-27-17-8-7-15-12-16(11-14-5-3-2-4-6-14)18(19(15)13-17)9-10-25-20(26)21(22,23)24/h2-8,13H,9-12H2,1H3,(H,25,26).
What are the key properties of N-[2-(2-benzyl-6-methoxy-3H-inden-1-yl)ethyl]-2,2,2-trifluoroacetamide?
N-[2-(2-benzyl-6-methoxy-3H-inden-1-yl)ethyl]-2,2,2-trifluoroacetamide has a molecular weight of 375.39 g/mol, XLogP of 4.32, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(2-benzyl-6-methoxy-3H-inden-1-yl)ethyl]-2,2,2-trifluoroacetamide is sourced from PubChem (CID 11100842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).