C17H17N3O5S — CID 11100844
2-(oxaloamino)-6-(2-pyridin-4-ylethyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylic acid (PubChem CID 11100844) has the molecular formula C17H17N3O5S and a molecular weight of 375.41 g/mol. Its IUPAC name is 2-(oxaloamino)-6-(2-pyridin-4-ylethyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylic acid.
| Compound Name | 2-(oxaloamino)-6-(2-pyridin-4-ylethyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 11100844 |
| Molecular Formula | C17H17N3O5S |
| Molecular Weight | 375.41 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | 2-(oxaloamino)-6-(2-pyridin-4-ylethyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylic acid |
| SMILES | O=C(O)C(=O)Nc1sc2c(c1C(=O)O)CCN(CCc1ccncc1)C2 |
| InChI | InChI=1S/C17H17N3O5S/c21-14(17(24)25)19-15-13(16(22)23)11-4-8-20(9-12(11)26-15)7-3-10-1-5-18-6-2-10/h1-2,5-6H,3-4,7-9H2,(H,19,21)(H,22,23)(H,24,25) |
| InChIKey | WFLNXQZSNQACIO-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 119.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.41 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|