C20H25NO6 — CID 11100846
[(1R,2S,3S,4S,5R)-3-[acetyl(prop-2-enyl)amino]-4-phenylmethoxy-6,8-dioxabicyclo[3.2.1]octan-2-yl] acetate (PubChem CID 11100846) has the molecular formula C20H25NO6 and a molecular weight of 375.42 g/mol. Its IUPAC name is [(1R,2S,3S,4S,5R)-3-[acetyl(prop-2-enyl)amino]-4-phenylmethoxy-6,8-dioxabicyclo[3.2.1]octan-2-yl] acetate.
| Compound Name | [(1R,2S,3S,4S,5R)-3-[acetyl(prop-2-enyl)amino]-4-phenylmethoxy-6,8-dioxabicyclo[3.2.1]octan-2-yl] acetate |
|---|---|
| PubChem CID | 11100846 |
| Molecular Formula | C20H25NO6 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | [(1R,2S,3S,4S,5R)-3-[acetyl(prop-2-enyl)amino]-4-phenylmethoxy-6,8-dioxabicyclo[3.2.1]octan-2-yl] acetate |
| SMILES | C=CCN(C(C)=O)[C@@H]1[C@H](OCc2ccccc2)[C@@H]2OC[C@@H](O2)[C@H]1OC(C)=O |
| InChI | InChI=1S/C20H25NO6/c1-4-10-21(13(2)22)17-18(26-14(3)23)16-12-25-20(27-16)19(17)24-11-15-8-6-5-7-9-15/h4-9,16-20H,1,10-12H2,2-3H3/t16-,17+,18-,19+,20-/m1/s1 |
| InChIKey | TWUFUFKESXWQBU-UJMXGEILSA-N |
| XLogP | 1.66 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|