C20H37IN6O — CID 111008824
1-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-2-methyl-3-[2-(4-methyl-1,4-diazepan-1-yl)ethyl]guanidine;hydroiodide (PubChem CID 111008824) has the molecular formula C20H37IN6O and a molecular weight of 504.46 g/mol. Its IUPAC name is 1-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-2-methyl-3-[2-(4-methyl-1,4-diazepan-1-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-2-methyl-3-[2-(4-methyl-1,4-diazepan-1-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111008824 |
| Molecular Formula | C20H37IN6O |
| Molecular Weight | 504.46 g/mol |
| Exact Mass | 504.21 |
| IUPAC Name | 1-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-2-methyl-3-[2-(4-methyl-1,4-diazepan-1-yl)ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCN1CCCN(C)CC1)NCC(c1ccco1)N1CCCC1.I |
| InChI | InChI=1S/C20H36N6O.HI/c1-21-20(22-8-13-25-10-6-9-24(2)14-15-25)23-17-18(19-7-5-16-27-19)26-11-3-4-12-26;/h5,7,16,18H,3-4,6,8-15,17H2,1-2H3,(H2,21,22,23);1H |
| InChIKey | YQYAHIWDKBWDEE-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.46 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|