C18H31N5O2 — CID 111008887
3-[[ethylamino-[[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]amino]methylidene]amino]-2,2-dimethylpropanamide (PubChem CID 111008887) has the molecular formula C18H31N5O2 and a molecular weight of 349.48 g/mol. Its IUPAC name is 3-[[ethylamino-[[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]amino]methylidene]amino]-2,2-dimethylpropanamide.
| Compound Name | 3-[[ethylamino-[[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]amino]methylidene]amino]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 111008887 |
| Molecular Formula | C18H31N5O2 |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.25 |
| IUPAC Name | 3-[[ethylamino-[[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]amino]methylidene]amino]-2,2-dimethylpropanamide |
| SMILES | CCN/C(=N\CC(C)(C)C(N)=O)NCC(c1ccco1)N1CCCC1 |
| InChI | InChI=1S/C18H31N5O2/c1-4-20-17(22-13-18(2,3)16(19)24)21-12-14(15-8-7-11-25-15)23-9-5-6-10-23/h7-8,11,14H,4-6,9-10,12-13H2,1-3H3,(H2,19,24)(H2,20,21,22) |
| InChIKey | UWFNGVLUQIQGDY-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 95.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|