C23H32O5 — CID 11101154
Androst-5-ene-3,11,17-trione, Cyclic 3,17-Bis(1,2-ethanediyl acetal) (PubChem CID 11101154) has the molecular formula C23H32O5 and a molecular weight of 388.50 g/mol.
| Compound Name | Androst-5-ene-3,11,17-trione, Cyclic 3,17-Bis(1,2-ethanediyl acetal) |
|---|---|
| PubChem CID | 11101154 |
| Molecular Formula | C23H32O5 |
| Molecular Weight | 388.50 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | — |
| SMILES | C[C@]12CCC3(CC1=CC[C@@H]1[C@@H]2C(=O)C[C@@]2(C)[C@H]1CCC21OCCO1)OCCO3 |
| InChI | InChI=1S/C23H32O5/c1-20-7-8-22(25-9-10-26-22)13-15(20)3-4-16-17-5-6-23(27-11-12-28-23)21(17,2)14-18(24)19(16)20/h3,16-17,19H,4-14H2,1-2H3/t16-,17-,19+,20-,21-/m0/s1 |
| InChIKey | RETKBEOWDBJXFZ-WJRACZLCSA-N |
| XLogP | 3.61 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.50 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|