C23H35N5OS — CID 111012357
1-[2-(dimethylamino)-2-(3-methoxyphenyl)ethyl]-2-methyl-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine (PubChem CID 111012357) has the molecular formula C23H35N5OS and a molecular weight of 429.63 g/mol. Its IUPAC name is 1-[2-(dimethylamino)-2-(3-methoxyphenyl)ethyl]-2-methyl-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine.
| Compound Name | 1-[2-(dimethylamino)-2-(3-methoxyphenyl)ethyl]-2-methyl-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111012357 |
| Molecular Formula | C23H35N5OS |
| Molecular Weight | 429.63 g/mol |
| Exact Mass | 429.26 |
| IUPAC Name | 1-[2-(dimethylamino)-2-(3-methoxyphenyl)ethyl]-2-methyl-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine |
| SMILES | C/N=C(/NCC(c1cccc(OC)c1)N(C)C)NCC(c1cccs1)N1CCCC1 |
| InChI | InChI=1S/C23H35N5OS/c1-24-23(25-16-20(27(2)3)18-9-7-10-19(15-18)29-4)26-17-21(22-11-8-14-30-22)28-12-5-6-13-28/h7-11,14-15,20-21H,5-6,12-13,16-17H2,1-4H3,(H2,24,25,26) |
| InChIKey | IDWZHJJHNGKUFH-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 52.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.63 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|