C28H25NO — CID 11101236
(2R,4R,5R)-3-benzyl-2,4,5-triphenyl-1,3-oxazolidine (PubChem CID 11101236) has the molecular formula C28H25NO and a molecular weight of 391.51 g/mol. Its IUPAC name is (2R,4R,5R)-3-benzyl-2,4,5-triphenyl-1,3-oxazolidine.
| Compound Name | (2R,4R,5R)-3-benzyl-2,4,5-triphenyl-1,3-oxazolidine |
|---|---|
| PubChem CID | 11101236 |
| Molecular Formula | C28H25NO |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | (2R,4R,5R)-3-benzyl-2,4,5-triphenyl-1,3-oxazolidine |
| SMILES | c1ccc(CN2[C@@H](c3ccccc3)O[C@H](c3ccccc3)[C@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C28H25NO/c1-5-13-22(14-6-1)21-29-26(23-15-7-2-8-16-23)27(24-17-9-3-10-18-24)30-28(29)25-19-11-4-12-20-25/h1-20,26-28H,21H2/t26-,27-,28-/m1/s1 |
| InChIKey | VMXKCRCBEQDUCA-JCYYIGJDSA-N |
| XLogP | 6.70 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |