C23H42O3Si — CID 11101318
methyl 4-[(3R,3aS,7S,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-3-prop-1-en-2-yl-1,2,3,4,5,6,7,7a-octahydroinden-3a-yl]butanoate (PubChem CID 11101318) has the molecular formula C23H42O3Si and a molecular weight of 394.67 g/mol. Its IUPAC name is methyl 4-[(3R,3aS,7S,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-3-prop-1-en-2-yl-1,2,3,4,5,6,7,7a-octahydroinden-3a-yl]butanoate.
| Compound Name | methyl 4-[(3R,3aS,7S,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-3-prop-1-en-2-yl-1,2,3,4,5,6,7,7a-octahydroinden-3a-yl]butanoate |
|---|---|
| PubChem CID | 11101318 |
| Molecular Formula | C23H42O3Si |
| Molecular Weight | 394.67 g/mol |
| Exact Mass | 394.29 |
| IUPAC Name | methyl 4-[(3R,3aS,7S,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-3-prop-1-en-2-yl-1,2,3,4,5,6,7,7a-octahydroinden-3a-yl]butanoate |
| SMILES | C=C(C)[C@H]1CC[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)CCC[C@]12CCCC(=O)OC |
| InChI | InChI=1S/C23H42O3Si/c1-17(2)18-13-14-19-20(26-27(7,8)22(3,4)5)11-9-15-23(18,19)16-10-12-21(24)25-6/h18-20H,1,9-16H2,2-8H3/t18-,19+,20+,23+/m1/s1 |
| InChIKey | OAVPNDJGOYAEKW-NVJIOZQYSA-N |
| XLogP | 6.49 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.67 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|