C21H27NO7 — CID 11101548
[(1S,5R,6R,7R,8R)-6,7-diacetyloxy-5-(phenylmethoxymethyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl] acetate (PubChem CID 11101548) has the molecular formula C21H27NO7 and a molecular weight of 405.45 g/mol. Its IUPAC name is [(1S,5R,6R,7R,8R)-6,7-diacetyloxy-5-(phenylmethoxymethyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl] acetate.
| Compound Name | [(1S,5R,6R,7R,8R)-6,7-diacetyloxy-5-(phenylmethoxymethyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl] acetate |
|---|---|
| PubChem CID | 11101548 |
| Molecular Formula | C21H27NO7 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | [(1S,5R,6R,7R,8R)-6,7-diacetyloxy-5-(phenylmethoxymethyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H](OC(C)=O)[C@@H](COCc2ccccc2)N2CC[C@H](OC(C)=O)[C@H]12 |
| InChI | InChI=1S/C21H27NO7/c1-13(23)27-18-9-10-22-17(12-26-11-16-7-5-4-6-8-16)20(28-14(2)24)21(19(18)22)29-15(3)25/h4-8,17-21H,9-12H2,1-3H3/t17-,18+,19-,20-,21-/m1/s1 |
| InChIKey | VWJDTESYZHPWAH-FDKIHUSFSA-N |
| XLogP | 1.45 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|