C17H16Br2N2 — CID 11101604
4,12-dibromo-3,11-dimethyl-1,9-diazatetracyclo[7.7.1.02,7.010,15]heptadeca-2(7),3,5,10(15),11,13-hexaene (PubChem CID 11101604) has the molecular formula C17H16Br2N2 and a molecular weight of 408.14 g/mol. Its IUPAC name is 4,12-dibromo-3,11-dimethyl-1,9-diazatetracyclo[7.7.1.02,7.010,15]heptadeca-2(7),3,5,10(15),11,13-hexaene.
| Compound Name | 4,12-dibromo-3,11-dimethyl-1,9-diazatetracyclo[7.7.1.02,7.010,15]heptadeca-2(7),3,5,10(15),11,13-hexaene |
|---|---|
| PubChem CID | 11101604 |
| Molecular Formula | C17H16Br2N2 |
| Molecular Weight | 408.14 g/mol |
| Exact Mass | 405.97 |
| IUPAC Name | 4,12-dibromo-3,11-dimethyl-1,9-diazatetracyclo[7.7.1.02,7.010,15]heptadeca-2(7),3,5,10(15),11,13-hexaene |
| SMILES | Cc1c(Br)ccc2c1N1Cc3ccc(Br)c(C)c3N(C2)C1 |
| InChI | InChI=1S/C17H16Br2N2/c1-10-14(18)5-3-12-7-21-9-20(16(10)12)8-13-4-6-15(19)11(2)17(13)21/h3-6H,7-9H2,1-2H3 |
| InChIKey | BZBPEHXYRVUPGV-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.14 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |