C21H34F2N4O2 — CID 111017023
2-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]-1-ethyl-3-(1-propylpiperidin-4-yl)guanidine (PubChem CID 111017023) has the molecular formula C21H34F2N4O2 and a molecular weight of 412.53 g/mol. Its IUPAC name is 2-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]-1-ethyl-3-(1-propylpiperidin-4-yl)guanidine.
| Compound Name | 2-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]-1-ethyl-3-(1-propylpiperidin-4-yl)guanidine |
|---|---|
| PubChem CID | 111017023 |
| Molecular Formula | C21H34F2N4O2 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.26 |
| IUPAC Name | 2-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]-1-ethyl-3-(1-propylpiperidin-4-yl)guanidine |
| SMILES | CCCN1CCC(N/C(=N/Cc2ccc(OC(F)F)c(OCC)c2)NCC)CC1 |
| InChI | InChI=1S/C21H34F2N4O2/c1-4-11-27-12-9-17(10-13-27)26-21(24-5-2)25-15-16-7-8-18(29-20(22)23)19(14-16)28-6-3/h7-8,14,17,20H,4-6,9-13,15H2,1-3H3,(H2,24,25,26) |
| InChIKey | UWYFTAQJPAJJLS-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|