C21H37IN4O2 — CID 111017626
1-[3-(3,4-dimethoxyphenyl)propyl]-2-methyl-3-(1-propylpiperidin-4-yl)guanidine;hydroiodide (PubChem CID 111017626) has the molecular formula C21H37IN4O2 and a molecular weight of 504.46 g/mol. Its IUPAC name is 1-[3-(3,4-dimethoxyphenyl)propyl]-2-methyl-3-(1-propylpiperidin-4-yl)guanidine;hydroiodide.
| Compound Name | 1-[3-(3,4-dimethoxyphenyl)propyl]-2-methyl-3-(1-propylpiperidin-4-yl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111017626 |
| Molecular Formula | C21H37IN4O2 |
| Molecular Weight | 504.46 g/mol |
| Exact Mass | 504.20 |
| IUPAC Name | 1-[3-(3,4-dimethoxyphenyl)propyl]-2-methyl-3-(1-propylpiperidin-4-yl)guanidine;hydroiodide |
| SMILES | CCCN1CCC(N/C(=N/C)NCCCc2ccc(OC)c(OC)c2)CC1.I |
| InChI | InChI=1S/C21H36N4O2.HI/c1-5-13-25-14-10-18(11-15-25)24-21(22-2)23-12-6-7-17-8-9-19(26-3)20(16-17)27-4;/h8-9,16,18H,5-7,10-15H2,1-4H3,(H2,22,23,24);1H |
| InChIKey | NCWRKVGBNDQSSX-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.46 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|