C21H32IN5S — CID 111018582
1-ethyl-2-[(2-phenyl-1,3-thiazol-4-yl)methyl]-3-(1-propylpiperidin-4-yl)guanidine;hydroiodide (PubChem CID 111018582) has the molecular formula C21H32IN5S and a molecular weight of 513.49 g/mol. Its IUPAC name is 1-ethyl-2-[(2-phenyl-1,3-thiazol-4-yl)methyl]-3-(1-propylpiperidin-4-yl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[(2-phenyl-1,3-thiazol-4-yl)methyl]-3-(1-propylpiperidin-4-yl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111018582 |
| Molecular Formula | C21H32IN5S |
| Molecular Weight | 513.49 g/mol |
| Exact Mass | 513.14 |
| IUPAC Name | 1-ethyl-2-[(2-phenyl-1,3-thiazol-4-yl)methyl]-3-(1-propylpiperidin-4-yl)guanidine;hydroiodide |
| SMILES | CCCN1CCC(N/C(=N/Cc2csc(-c3ccccc3)n2)NCC)CC1.I |
| InChI | InChI=1S/C21H31N5S.HI/c1-3-12-26-13-10-18(11-14-26)25-21(22-4-2)23-15-19-16-27-20(24-19)17-8-6-5-7-9-17;/h5-9,16,18H,3-4,10-15H2,1-2H3,(H2,22,23,25);1H |
| InChIKey | PEQCFECBBSOSHW-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.49 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|