C24H41N5O2 — CID 111020913
1-ethyl-3-[2-(2-methoxyphenyl)-2-piperidin-1-ylethyl]-2-(2-morpholin-4-ylpropyl)guanidine (PubChem CID 111020913) has the molecular formula C24H41N5O2 and a molecular weight of 431.63 g/mol. Its IUPAC name is 1-ethyl-3-[2-(2-methoxyphenyl)-2-piperidin-1-ylethyl]-2-(2-morpholin-4-ylpropyl)guanidine.
| Compound Name | 1-ethyl-3-[2-(2-methoxyphenyl)-2-piperidin-1-ylethyl]-2-(2-morpholin-4-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111020913 |
| Molecular Formula | C24H41N5O2 |
| Molecular Weight | 431.63 g/mol |
| Exact Mass | 431.33 |
| IUPAC Name | 1-ethyl-3-[2-(2-methoxyphenyl)-2-piperidin-1-ylethyl]-2-(2-morpholin-4-ylpropyl)guanidine |
| SMILES | CCN/C(=N\CC(C)N1CCOCC1)NCC(c1ccccc1OC)N1CCCCC1 |
| InChI | InChI=1S/C24H41N5O2/c1-4-25-24(26-18-20(2)28-14-16-31-17-15-28)27-19-22(29-12-8-5-9-13-29)21-10-6-7-11-23(21)30-3/h6-7,10-11,20,22H,4-5,8-9,12-19H2,1-3H3,(H2,25,26,27) |
| InChIKey | KLSJYWOXDPMIJA-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.63 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|