C18H18N8O2S2 — CID 11102278
3-[[2-tert-butyl-4-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-3-ylmethoxy)phenoxy]methyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole (PubChem CID 11102278) has the molecular formula C18H18N8O2S2 and a molecular weight of 442.53 g/mol. Its IUPAC name is 3-[[2-tert-butyl-4-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-3-ylmethoxy)phenoxy]methyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole.
| Compound Name | 3-[[2-tert-butyl-4-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-3-ylmethoxy)phenoxy]methyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 11102278 |
| Molecular Formula | C18H18N8O2S2 |
| Molecular Weight | 442.53 g/mol |
| Exact Mass | 442.10 |
| IUPAC Name | 3-[[2-tert-butyl-4-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-3-ylmethoxy)phenoxy]methyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
| SMILES | CC(C)(C)c1cc(OCc2nnc3scnn23)ccc1OCc1nnc2scnn12 |
| InChI | InChI=1S/C18H18N8O2S2/c1-18(2,3)12-6-11(27-7-14-21-23-16-25(14)19-9-29-16)4-5-13(12)28-8-15-22-24-17-26(15)20-10-30-17/h4-6,9-10H,7-8H2,1-3H3 |
| InChIKey | WTCVKMPFHMESQY-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 104.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.53 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |