About ethyl 2-(5'-bromo-2'-oxospiro[1,3-dioxane-2,3'-indole]-1'-yl)acetate
ethyl 2-(5'-bromo-2'-oxospiro[1,3-dioxane-2,3'-indole]-1'-yl)acetate (PubChem CID 1110230) has the molecular formula C15H16BrNO5
and a molecular weight of 370.20 g/mol. Its IUPAC name is ethyl 2-(5'-bromo-2'-oxospiro[1,3-dioxane-2,3'-indole]-1'-yl)acetate.
Molecular Properties
| Compound Name | ethyl 2-(5'-bromo-2'-oxospiro[1,3-dioxane-2,3'-indole]-1'-yl)acetate |
| PubChem CID | 1110230 |
| Molecular Formula | C15H16BrNO5 |
| Molecular Weight | 370.20 g/mol |
| Exact Mass | 369.02 |
| IUPAC Name | ethyl 2-(5'-bromo-2'-oxospiro[1,3-dioxane-2,3'-indole]-1'-yl)acetate |
| SMILES | CCOC(=O)CN1C(=O)C2(OCCCO2)c2cc(Br)ccc21 |
| InChI | InChI=1S/C15H16BrNO5/c1-2-20-13(18)9-17-12-5-4-10(16)8-11(12)15(14(17)19)21-6-3-7-22-15/h4-5,8H,2-3,6-7,9H2,1H3 |
| InChIKey | DKFZDXXUXMQHKW-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.20 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 2-(5'-bromo-2'-oxospiro[1,3-dioxane-2,3'-indole]-1'-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(5'-bromo-2'-oxospiro[1,3-dioxane-2,3'-indole]-1'-yl)acetate?
The IUPAC name of ethyl 2-(5'-bromo-2'-oxospiro[1,3-dioxane-2,3'-indole]-1'-yl)acetate (CID 1110230) is ethyl 2-(5'-bromo-2'-oxospiro[1,3-dioxane-2,3'-indole]-1'-yl)acetate.
What is the SMILES notation for ethyl 2-(5'-bromo-2'-oxospiro[1,3-dioxane-2,3'-indole]-1'-yl)acetate?
The canonical SMILES for ethyl 2-(5'-bromo-2'-oxospiro[1,3-dioxane-2,3'-indole]-1'-yl)acetate is CCOC(=O)CN1C(=O)C2(OCCCO2)c2cc(Br)ccc21.
What is the InChIKey of ethyl 2-(5'-bromo-2'-oxospiro[1,3-dioxane-2,3'-indole]-1'-yl)acetate?
The InChIKey is DKFZDXXUXMQHKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16BrNO5/c1-2-20-13(18)9-17-12-5-4-10(16)8-11(12)15(14(17)19)21-6-3-7-22-15/h4-5,8H,2-3,6-7,9H2,1H3.
What are the key properties of ethyl 2-(5'-bromo-2'-oxospiro[1,3-dioxane-2,3'-indole]-1'-yl)acetate?
ethyl 2-(5'-bromo-2'-oxospiro[1,3-dioxane-2,3'-indole]-1'-yl)acetate has a molecular weight of 370.20 g/mol, XLogP of 1.95, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(5'-bromo-2'-oxospiro[1,3-dioxane-2,3'-indole]-1'-yl)acetate is sourced from PubChem (CID 1110230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).