C23H39NO4Si2 — CID 11102405
(3S,4S)-1-benzyl-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]pyrrolidine-2,5-dione (PubChem CID 11102405) has the molecular formula C23H39NO4Si2 and a molecular weight of 449.74 g/mol. Its IUPAC name is (3S,4S)-1-benzyl-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]pyrrolidine-2,5-dione.
| Compound Name | (3S,4S)-1-benzyl-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 11102405 |
| Molecular Formula | C23H39NO4Si2 |
| Molecular Weight | 449.74 g/mol |
| Exact Mass | 449.24 |
| IUPAC Name | (3S,4S)-1-benzyl-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]pyrrolidine-2,5-dione |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C(=O)N(Cc2ccccc2)C(=O)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H39NO4Si2/c1-22(2,3)29(7,8)27-18-19(28-30(9,10)23(4,5)6)21(26)24(20(18)25)16-17-14-12-11-13-15-17/h11-15,18-19H,16H2,1-10H3/t18-,19-/m0/s1 |
| InChIKey | QBRWBUQECIDMIJ-OALUTQOASA-N |
| XLogP | 5.34 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.74 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|