C19H26INO4 — CID 11102555
propan-2-yl 2-[(4R,6R)-6-[(1S)-1-iodoethyl]-2-oxo-3-[(1R)-1-phenylethyl]-1,3-oxazinan-4-yl]acetate (PubChem CID 11102555) has the molecular formula C19H26INO4 and a molecular weight of 459.32 g/mol. Its IUPAC name is propan-2-yl 2-[(4R,6R)-6-[(1S)-1-iodoethyl]-2-oxo-3-[(1R)-1-phenylethyl]-1,3-oxazinan-4-yl]acetate.
| Compound Name | propan-2-yl 2-[(4R,6R)-6-[(1S)-1-iodoethyl]-2-oxo-3-[(1R)-1-phenylethyl]-1,3-oxazinan-4-yl]acetate |
|---|---|
| PubChem CID | 11102555 |
| Molecular Formula | C19H26INO4 |
| Molecular Weight | 459.32 g/mol |
| Exact Mass | 459.09 |
| IUPAC Name | propan-2-yl 2-[(4R,6R)-6-[(1S)-1-iodoethyl]-2-oxo-3-[(1R)-1-phenylethyl]-1,3-oxazinan-4-yl]acetate |
| SMILES | CC(C)OC(=O)C[C@H]1C[C@H]([C@H](C)I)OC(=O)N1[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C19H26INO4/c1-12(2)24-18(22)11-16-10-17(13(3)20)25-19(23)21(16)14(4)15-8-6-5-7-9-15/h5-9,12-14,16-17H,10-11H2,1-4H3/t13-,14+,16+,17+/m0/s1 |
| InChIKey | LHERVNXBHUCWPM-XOSAIJSUSA-N |
| XLogP | 4.49 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.32 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|