C12H25N3O2 — CID 111025589
ethyl 4-[[amino-(3-methylbutylamino)methylidene]amino]butanoate (PubChem CID 111025589) has the molecular formula C12H25N3O2 and a molecular weight of 243.35 g/mol. Its IUPAC name is ethyl 4-[[amino-(3-methylbutylamino)methylidene]amino]butanoate.
| Compound Name | ethyl 4-[[amino-(3-methylbutylamino)methylidene]amino]butanoate |
|---|---|
| PubChem CID | 111025589 |
| Molecular Formula | C12H25N3O2 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.19 |
| IUPAC Name | ethyl 4-[[amino-(3-methylbutylamino)methylidene]amino]butanoate |
| SMILES | CCOC(=O)CCC/N=C(\N)NCCC(C)C |
| InChI | InChI=1S/C12H25N3O2/c1-4-17-11(16)6-5-8-14-12(13)15-9-7-10(2)3/h10H,4-9H2,1-3H3,(H3,13,14,15) |
| InChIKey | QTTXOFZGCIONKC-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|